C4H4F3O4P — CID 57355994
oxido-oxo-(4,4,4-trifluoro-2-oxobutoxy)phosphanium (PubChem CID 57355994) has the molecular formula C4H4F3O4P and a molecular weight of 204.04 g/mol. Its IUPAC name is oxido-oxo-(4,4,4-trifluoro-2-oxobutoxy)phosphanium.
| Compound Name | oxido-oxo-(4,4,4-trifluoro-2-oxobutoxy)phosphanium |
|---|---|
| PubChem CID | 57355994 |
| Molecular Formula | C4H4F3O4P |
| Molecular Weight | 204.04 g/mol |
| Exact Mass | 203.98 |
| IUPAC Name | oxido-oxo-(4,4,4-trifluoro-2-oxobutoxy)phosphanium |
| SMILES | O=C(CO[P+](=O)[O-])CC(F)(F)F |
| InChI | InChI=1S/C4H4F3O4P/c5-4(6,7)1-3(8)2-11-12(9)10/h1-2H2 |
| InChIKey | YTLGMIRNZFFKFU-UHFFFAOYSA-N |
| XLogP | 0.54 |
| TPSA | 66.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.04 |
| LogP ≤ 5 | 0.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|