C8H9F5O2 — CID 130395599
7,7,8,8,8-pentafluorooctane-3,5-dione (PubChem CID 130395599) has the molecular formula C8H9F5O2 and a molecular weight of 232.15 g/mol. Its IUPAC name is 7,7,8,8,8-pentafluorooctane-3,5-dione.
| Compound Name | 7,7,8,8,8-pentafluorooctane-3,5-dione |
|---|---|
| PubChem CID | 130395599 |
| Molecular Formula | C8H9F5O2 |
| Molecular Weight | 232.15 g/mol |
| Exact Mass | 232.05 |
| IUPAC Name | 7,7,8,8,8-pentafluorooctane-3,5-dione |
| SMILES | CCC(=O)CC(=O)CC(F)(F)C(F)(F)F |
| InChI | InChI=1S/C8H9F5O2/c1-2-5(14)3-6(15)4-7(9,10)8(11,12)13/h2-4H2,1H3 |
| InChIKey | LFYHMKNYJRNKEV-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.15 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|