C10H15F5O2 — CID 162194215
2,2-dimethylbutyl 3,3,4,4,4-pentafluorobutanoate (PubChem CID 162194215) has the molecular formula C10H15F5O2 and a molecular weight of 262.22 g/mol. Its IUPAC name is 2,2-dimethylbutyl 3,3,4,4,4-pentafluorobutanoate.
| Compound Name | 2,2-dimethylbutyl 3,3,4,4,4-pentafluorobutanoate |
|---|---|
| PubChem CID | 162194215 |
| Molecular Formula | C10H15F5O2 |
| Molecular Weight | 262.22 g/mol |
| Exact Mass | 262.10 |
| IUPAC Name | 2,2-dimethylbutyl 3,3,4,4,4-pentafluorobutanoate |
| SMILES | CCC(C)(C)COC(=O)CC(F)(F)C(F)(F)F |
| InChI | InChI=1S/C10H15F5O2/c1-4-8(2,3)6-17-7(16)5-9(11,12)10(13,14)15/h4-6H2,1-3H3 |
| InChIKey | AHRXEZOOEYFLQA-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.22 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|