C16H25F5O4 — CID 89163980
[2-oxo-2-(2,2,3,3,3-pentafluoropropoxy)ethyl] 2-ethyl-2,4,4-trimethylhexanoate (PubChem CID 89163980) has the molecular formula C16H25F5O4 and a molecular weight of 376.36 g/mol. Its IUPAC name is [2-oxo-2-(2,2,3,3,3-pentafluoropropoxy)ethyl] 2-ethyl-2,4,4-trimethylhexanoate.
| Compound Name | [2-oxo-2-(2,2,3,3,3-pentafluoropropoxy)ethyl] 2-ethyl-2,4,4-trimethylhexanoate |
|---|---|
| PubChem CID | 89163980 |
| Molecular Formula | C16H25F5O4 |
| Molecular Weight | 376.36 g/mol |
| Exact Mass | 376.17 |
| IUPAC Name | [2-oxo-2-(2,2,3,3,3-pentafluoropropoxy)ethyl] 2-ethyl-2,4,4-trimethylhexanoate |
| SMILES | CCC(C)(C)CC(C)(CC)C(=O)OCC(=O)OCC(F)(F)C(F)(F)F |
| InChI | InChI=1S/C16H25F5O4/c1-6-13(3,4)9-14(5,7-2)12(23)24-8-11(22)25-10-15(17,18)16(19,20)21/h6-10H2,1-5H3 |
| InChIKey | UKKZOOLSENPPRX-UHFFFAOYSA-N |
| XLogP | 4.51 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.36 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|