About [2-oxo-2-(2,2,2-trifluoroethoxy)ethyl] 2,2-dimethylpentanoate
[2-oxo-2-(2,2,2-trifluoroethoxy)ethyl] 2,2-dimethylpentanoate (PubChem CID 126514204) has the molecular formula C11H17F3O4
and a molecular weight of 270.25 g/mol. Its IUPAC name is [2-oxo-2-(2,2,2-trifluoroethoxy)ethyl] 2,2-dimethylpentanoate.
Analyze [2-oxo-2-(2,2,2-trifluoroethoxy)ethyl] 2,2-dimethylpentanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-oxo-2-(2,2,2-trifluoroethoxy)ethyl] 2,2-dimethylpentanoate?
The IUPAC name of [2-oxo-2-(2,2,2-trifluoroethoxy)ethyl] 2,2-dimethylpentanoate (CID 126514204) is [2-oxo-2-(2,2,2-trifluoroethoxy)ethyl] 2,2-dimethylpentanoate.
What is the SMILES notation for [2-oxo-2-(2,2,2-trifluoroethoxy)ethyl] 2,2-dimethylpentanoate?
The canonical SMILES for [2-oxo-2-(2,2,2-trifluoroethoxy)ethyl] 2,2-dimethylpentanoate is CCCC(C)(C)C(=O)OCC(=O)OCC(F)(F)F.
What is the InChIKey of [2-oxo-2-(2,2,2-trifluoroethoxy)ethyl] 2,2-dimethylpentanoate?
The InChIKey is IDHCIZHSJLBMMD-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H17F3O4/c1-4-5-10(2,3)9(16)17-6-8(15)18-7-11(12,13)14/h4-7H2,1-3H3.
What are the key properties of [2-oxo-2-(2,2,2-trifluoroethoxy)ethyl] 2,2-dimethylpentanoate?
[2-oxo-2-(2,2,2-trifluoroethoxy)ethyl] 2,2-dimethylpentanoate has a molecular weight of 270.25 g/mol, XLogP of 2.46, 6 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [2-oxo-2-(2,2,2-trifluoroethoxy)ethyl] 2,2-dimethylpentanoate is sourced from PubChem (CID 126514204), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).