2,2,2-trifluoroethyl 2-ethyl-2-methylpentanoate

C10H17F3O2 — CID 139362815

IUPAC2,2,2-trifluoroethyl 2-ethyl-2-methylpentanoate
SMILESCCCC(C)(CC)C(=O)OCC(F)(F)F
InChIInChI=1S/C10H17F3O2/c1-4-6-9(3,5-2)8(14)15-7-10(11,12)13/h4-7H2,1-3H3
InChIKeyBHOJPUCMDBGMAI-UHFFFAOYSA-N
MW226.24 g/mol
LogP3.31
Rot. Bonds5

About 2,2,2-trifluoroethyl 2-ethyl-2-methylpentanoate

2,2,2-trifluoroethyl 2-ethyl-2-methylpentanoate (PubChem CID 139362815) has the molecular formula C10H17F3O2 and a molecular weight of 226.24 g/mol. Its IUPAC name is 2,2,2-trifluoroethyl 2-ethyl-2-methylpentanoate.

Molecular Properties

Compound Name2,2,2-trifluoroethyl 2-ethyl-2-methylpentanoate
PubChem CID139362815
Molecular FormulaC10H17F3O2
Molecular Weight226.24 g/mol
Exact Mass226.12
IUPAC Name2,2,2-trifluoroethyl 2-ethyl-2-methylpentanoate
SMILESCCCC(C)(CC)C(=O)OCC(F)(F)F
InChIInChI=1S/C10H17F3O2/c1-4-6-9(3,5-2)8(14)15-7-10(11,12)13/h4-7H2,1-3H3
InChIKeyBHOJPUCMDBGMAI-UHFFFAOYSA-N
XLogP3.31
TPSA26.30 Ų
H-Bond Donors
H-Bond Acceptors2
Rotatable Bonds5
Heavy Atoms15
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500226.24
LogP ≤ 53.31
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 102

Analyze 2,2,2-trifluoroethyl 2-ethyl-2-methylpentanoate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2,2,2-trifluoroethyl 2-ethyl-2-methylpentanoate?
The IUPAC name of 2,2,2-trifluoroethyl 2-ethyl-2-methylpentanoate (CID 139362815) is 2,2,2-trifluoroethyl 2-ethyl-2-methylpentanoate.
What is the SMILES notation for 2,2,2-trifluoroethyl 2-ethyl-2-methylpentanoate?
The canonical SMILES for 2,2,2-trifluoroethyl 2-ethyl-2-methylpentanoate is CCCC(C)(CC)C(=O)OCC(F)(F)F.
What is the InChIKey of 2,2,2-trifluoroethyl 2-ethyl-2-methylpentanoate?
The InChIKey is BHOJPUCMDBGMAI-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H17F3O2/c1-4-6-9(3,5-2)8(14)15-7-10(11,12)13/h4-7H2,1-3H3.
What are the key properties of 2,2,2-trifluoroethyl 2-ethyl-2-methylpentanoate?
2,2,2-trifluoroethyl 2-ethyl-2-methylpentanoate has a molecular weight of 226.24 g/mol, XLogP of 3.31, 5 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2,2,2-trifluoroethyl 2-ethyl-2-methylpentanoate is sourced from PubChem (CID 139362815), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).