About 2,2,2-trifluoroethyl 2-methyl-2-(trifluoromethyl)butanoate
2,2,2-trifluoroethyl 2-methyl-2-(trifluoromethyl)butanoate (PubChem CID 23594538) has the molecular formula C8H10F6O2
and a molecular weight of 252.15 g/mol. Its IUPAC name is 2,2,2-trifluoroethyl 2-methyl-2-(trifluoromethyl)butanoate.
Analyze 2,2,2-trifluoroethyl 2-methyl-2-(trifluoromethyl)butanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,2,2-trifluoroethyl 2-methyl-2-(trifluoromethyl)butanoate?
The IUPAC name of 2,2,2-trifluoroethyl 2-methyl-2-(trifluoromethyl)butanoate (CID 23594538) is 2,2,2-trifluoroethyl 2-methyl-2-(trifluoromethyl)butanoate.
What is the SMILES notation for 2,2,2-trifluoroethyl 2-methyl-2-(trifluoromethyl)butanoate?
The canonical SMILES for 2,2,2-trifluoroethyl 2-methyl-2-(trifluoromethyl)butanoate is CCC(C)(C(=O)OCC(F)(F)F)C(F)(F)F.
What is the InChIKey of 2,2,2-trifluoroethyl 2-methyl-2-(trifluoromethyl)butanoate?
The InChIKey is VOWHSMMRQRAUSI-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H10F6O2/c1-3-6(2,8(12,13)14)5(15)16-4-7(9,10)11/h3-4H2,1-2H3.
What are the key properties of 2,2,2-trifluoroethyl 2-methyl-2-(trifluoromethyl)butanoate?
2,2,2-trifluoroethyl 2-methyl-2-(trifluoromethyl)butanoate has a molecular weight of 252.15 g/mol, XLogP of 3.07, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2,2,2-trifluoroethyl 2-methyl-2-(trifluoromethyl)butanoate is sourced from PubChem (CID 23594538), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).