C12H17F5O4 — CID 129082246
ethyl 2-methyl-2-(2,2,3,3,3-pentafluoropropanoyloxymethyl)pentanoate (PubChem CID 129082246) has the molecular formula C12H17F5O4 and a molecular weight of 320.25 g/mol. Its IUPAC name is ethyl 2-methyl-2-(2,2,3,3,3-pentafluoropropanoyloxymethyl)pentanoate.
| Compound Name | ethyl 2-methyl-2-(2,2,3,3,3-pentafluoropropanoyloxymethyl)pentanoate |
|---|---|
| PubChem CID | 129082246 |
| Molecular Formula | C12H17F5O4 |
| Molecular Weight | 320.25 g/mol |
| Exact Mass | 320.10 |
| IUPAC Name | ethyl 2-methyl-2-(2,2,3,3,3-pentafluoropropanoyloxymethyl)pentanoate |
| SMILES | CCCC(C)(COC(=O)C(F)(F)C(F)(F)F)C(=O)OCC |
| InChI | InChI=1S/C12H17F5O4/c1-4-6-10(3,8(18)20-5-2)7-21-9(19)11(13,14)12(15,16)17/h4-7H2,1-3H3 |
| InChIKey | YPRZQOXVQACTEY-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.25 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|