C7H8F5NO4 — CID 154212931
(2-methyl-2-nitropropyl) 2,2,3,3,3-pentafluoropropanoate (PubChem CID 154212931) has the molecular formula C7H8F5NO4 and a molecular weight of 265.13 g/mol. Its IUPAC name is (2-methyl-2-nitropropyl) 2,2,3,3,3-pentafluoropropanoate.
| Compound Name | (2-methyl-2-nitropropyl) 2,2,3,3,3-pentafluoropropanoate |
|---|---|
| PubChem CID | 154212931 |
| Molecular Formula | C7H8F5NO4 |
| Molecular Weight | 265.13 g/mol |
| Exact Mass | 265.04 |
| IUPAC Name | (2-methyl-2-nitropropyl) 2,2,3,3,3-pentafluoropropanoate |
| SMILES | CC(C)(COC(=O)C(F)(F)C(F)(F)F)[N+](=O)[O-] |
| InChI | InChI=1S/C7H8F5NO4/c1-5(2,13(15)16)3-17-4(14)6(8,9)7(10,11)12/h3H2,1-2H3 |
| InChIKey | JEMNAVNDVGRPJI-UHFFFAOYSA-N |
| XLogP | 1.78 |
| TPSA | 69.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.13 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|