C20H35F5O10 — CID 91730617
2-[2-[2-[2-[2-[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethyl 2,2,3,3,3-pentafluoropropanoate (PubChem CID 91730617) has the molecular formula C20H35F5O10 and a molecular weight of 530.48 g/mol. Its IUPAC name is 2-[2-[2-[2-[2-[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethyl 2,2,3,3,3-pentafluoropropanoate.
| Compound Name | 2-[2-[2-[2-[2-[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethyl 2,2,3,3,3-pentafluoropropanoate |
|---|---|
| PubChem CID | 91730617 |
| Molecular Formula | C20H35F5O10 |
| Molecular Weight | 530.48 g/mol |
| Exact Mass | 530.22 |
| IUPAC Name | 2-[2-[2-[2-[2-[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethyl 2,2,3,3,3-pentafluoropropanoate |
| SMILES | COCCOCCOCCOCCOCCOCCOCCOCCOC(=O)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C20H35F5O10/c1-27-2-3-28-4-5-29-6-7-30-8-9-31-10-11-32-12-13-33-14-15-34-16-17-35-18(26)19(21,22)20(23,24)25/h2-17H2,1H3 |
| InChIKey | LPOOKINGGQHHSE-UHFFFAOYSA-N |
| XLogP | 1.49 |
| TPSA | 100.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 25 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.48 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|