C7H16O11P2 — CID 57249167
[1-hydroxy-2-[2-(2-methoxyethoxy)ethoxy]-2-oxo-1-phosphonoethyl]phosphonic acid (PubChem CID 57249167) has the molecular formula C7H16O11P2 and a molecular weight of 338.14 g/mol. Its IUPAC name is [1-hydroxy-2-[2-(2-methoxyethoxy)ethoxy]-2-oxo-1-phosphonoethyl]phosphonic acid.
| Compound Name | [1-hydroxy-2-[2-(2-methoxyethoxy)ethoxy]-2-oxo-1-phosphonoethyl]phosphonic acid |
|---|---|
| PubChem CID | 57249167 |
| Molecular Formula | C7H16O11P2 |
| Molecular Weight | 338.14 g/mol |
| Exact Mass | 338.02 |
| IUPAC Name | [1-hydroxy-2-[2-(2-methoxyethoxy)ethoxy]-2-oxo-1-phosphonoethyl]phosphonic acid |
| SMILES | COCCOCCOC(=O)C(O)(P(=O)(O)O)P(=O)(O)O |
| InChI | InChI=1S/C7H16O11P2/c1-16-2-3-17-4-5-18-6(8)7(9,19(10,11)12)20(13,14)15/h9H,2-5H2,1H3,(H2,10,11,12)(H2,13,14,15) |
| InChIKey | BPEXZLLFLHNTRT-UHFFFAOYSA-N |
| XLogP | -1.81 |
| TPSA | 180.05 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.14 |
| LogP ≤ 5 | -1.81 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|