C14H29NO5 — CID 104563189
2-[2-(2-methoxyethoxy)ethoxy]ethyl 2-(aminomethyl)-2-ethylbutanoate (PubChem CID 104563189) has the molecular formula C14H29NO5 and a molecular weight of 291.39 g/mol. Its IUPAC name is 2-[2-(2-methoxyethoxy)ethoxy]ethyl 2-(aminomethyl)-2-ethylbutanoate.
| Compound Name | 2-[2-(2-methoxyethoxy)ethoxy]ethyl 2-(aminomethyl)-2-ethylbutanoate |
|---|---|
| PubChem CID | 104563189 |
| Molecular Formula | C14H29NO5 |
| Molecular Weight | 291.39 g/mol |
| Exact Mass | 291.20 |
| IUPAC Name | 2-[2-(2-methoxyethoxy)ethoxy]ethyl 2-(aminomethyl)-2-ethylbutanoate |
| SMILES | CCC(CC)(CN)C(=O)OCCOCCOCCOC |
| InChI | InChI=1S/C14H29NO5/c1-4-14(5-2,12-15)13(16)20-11-10-19-9-8-18-7-6-17-3/h4-12,15H2,1-3H3 |
| InChIKey | GCWBPIYAFPANOM-UHFFFAOYSA-N |
| XLogP | 0.97 |
| TPSA | 80.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.39 |
| LogP ≤ 5 | 0.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|