C18H32N2O7 — CID 159535711
1,7-diisocyanatoheptane;2-methoxyethyl 2,2-bis(hydroxymethyl)butanoate (PubChem CID 159535711) has the molecular formula C18H32N2O7 and a molecular weight of 388.46 g/mol. Its IUPAC name is 1,7-diisocyanatoheptane;2-methoxyethyl 2,2-bis(hydroxymethyl)butanoate.
| Compound Name | 1,7-diisocyanatoheptane;2-methoxyethyl 2,2-bis(hydroxymethyl)butanoate |
|---|---|
| PubChem CID | 159535711 |
| Molecular Formula | C18H32N2O7 |
| Molecular Weight | 388.46 g/mol |
| Exact Mass | 388.22 |
| IUPAC Name | 1,7-diisocyanatoheptane;2-methoxyethyl 2,2-bis(hydroxymethyl)butanoate |
| SMILES | CCC(CO)(CO)C(=O)OCCOC.O=C=NCCCCCCCN=C=O |
| InChI | InChI=1S/C9H14N2O2.C9H18O5/c12-8-10-6-4-2-1-3-5-7-11-9-13;1-3-9(6-10,7-11)8(12)14-5-4-13-2/h1-7H2;10-11H,3-7H2,1-2H3 |
| InChIKey | MDOBPSHIIGLMQI-UHFFFAOYSA-N |
| XLogP | 1.17 |
| TPSA | 134.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.46 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isocyanate', 'substructure': 'N/A'} |
|---|