C11H21NO5 — CID 20751105
2-(ethenoxymethylamino)ethyl 2,2-bis(hydroxymethyl)butanoate (PubChem CID 20751105) has the molecular formula C11H21NO5 and a molecular weight of 247.29 g/mol. Its IUPAC name is 2-(ethenoxymethylamino)ethyl 2,2-bis(hydroxymethyl)butanoate.
| Compound Name | 2-(ethenoxymethylamino)ethyl 2,2-bis(hydroxymethyl)butanoate |
|---|---|
| PubChem CID | 20751105 |
| Molecular Formula | C11H21NO5 |
| Molecular Weight | 247.29 g/mol |
| Exact Mass | 247.14 |
| IUPAC Name | 2-(ethenoxymethylamino)ethyl 2,2-bis(hydroxymethyl)butanoate |
| SMILES | C=COCNCCOC(=O)C(CC)(CO)CO |
| InChI | InChI=1S/C11H21NO5/c1-3-11(7-13,8-14)10(15)17-6-5-12-9-16-4-2/h4,12-14H,2-3,5-9H2,1H3 |
| InChIKey | MCIRJTYFWJYXEM-UHFFFAOYSA-N |
| XLogP | -0.38 |
| TPSA | 88.02 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.29 |
| LogP ≤ 5 | -0.38 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|