C12H21NO6 — CID 58226179
[3-oxo-3-[2-(tritiooxycarbonylamino)ethoxy]propyl] 2,2-dimethylbutanoate (PubChem CID 58226179) has the molecular formula C12H21NO6 and a molecular weight of 277.31 g/mol. Its IUPAC name is [3-oxo-3-[2-(tritiooxycarbonylamino)ethoxy]propyl] 2,2-dimethylbutanoate.
| Compound Name | [3-oxo-3-[2-(tritiooxycarbonylamino)ethoxy]propyl] 2,2-dimethylbutanoate |
|---|---|
| PubChem CID | 58226179 |
| Molecular Formula | C12H21NO6 |
| Molecular Weight | 277.31 g/mol |
| Exact Mass | 277.15 |
| IUPAC Name | [3-oxo-3-[2-(tritiooxycarbonylamino)ethoxy]propyl] 2,2-dimethylbutanoate |
| SMILES | [3H]OC(=O)NCCOC(=O)CCOC(=O)C(C)(C)CC |
| InChI | InChI=1S/C12H21NO6/c1-4-12(2,3)10(15)19-7-5-9(14)18-8-6-13-11(16)17/h13H,4-8H2,1-3H3,(H,16,17)/i/hT |
| InChIKey | NFUOJTLRJPXNMD-MNYXATJNSA-N |
| XLogP | 1.17 |
| TPSA | 101.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.31 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|