C24H43NO6 — CID 58422363
3-cyclohexylpropyl 6-[2-(2,2-dimethylbutanoyloxy)ethylcarbamoyloxy]hexanoate (PubChem CID 58422363) has the molecular formula C24H43NO6 and a molecular weight of 441.61 g/mol. Its IUPAC name is 3-cyclohexylpropyl 6-[2-(2,2-dimethylbutanoyloxy)ethylcarbamoyloxy]hexanoate.
| Compound Name | 3-cyclohexylpropyl 6-[2-(2,2-dimethylbutanoyloxy)ethylcarbamoyloxy]hexanoate |
|---|---|
| PubChem CID | 58422363 |
| Molecular Formula | C24H43NO6 |
| Molecular Weight | 441.61 g/mol |
| Exact Mass | 441.31 |
| IUPAC Name | 3-cyclohexylpropyl 6-[2-(2,2-dimethylbutanoyloxy)ethylcarbamoyloxy]hexanoate |
| SMILES | CCC(C)(C)C(=O)OCCNC(=O)OCCCCCC(=O)OCCCC1CCCCC1 |
| InChI | InChI=1S/C24H43NO6/c1-4-24(2,3)22(27)30-19-16-25-23(28)31-17-10-6-9-15-21(26)29-18-11-14-20-12-7-5-8-13-20/h20H,4-19H2,1-3H3,(H,25,28) |
| InChIKey | LTKKFDQWCVSCNZ-UHFFFAOYSA-N |
| XLogP | 5.16 |
| TPSA | 90.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.61 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|