C28H54NO11P — CID 123668561
2-(2,2-dimethylbutanoyloxy)ethylphosphonic acid;3-methylbutyl 6-[2-(2,2-dimethylbutanoyloxy)ethylcarbamoyloxy]hexanoate (PubChem CID 123668561) has the molecular formula C28H54NO11P and a molecular weight of 611.71 g/mol. Its IUPAC name is 2-(2,2-dimethylbutanoyloxy)ethylphosphonic acid;3-methylbutyl 6-[2-(2,2-dimethylbutanoyloxy)ethylcarbamoyloxy]hexanoate.
| Compound Name | 2-(2,2-dimethylbutanoyloxy)ethylphosphonic acid;3-methylbutyl 6-[2-(2,2-dimethylbutanoyloxy)ethylcarbamoyloxy]hexanoate |
|---|---|
| PubChem CID | 123668561 |
| Molecular Formula | C28H54NO11P |
| Molecular Weight | 611.71 g/mol |
| Exact Mass | 611.34 |
| IUPAC Name | 2-(2,2-dimethylbutanoyloxy)ethylphosphonic acid;3-methylbutyl 6-[2-(2,2-dimethylbutanoyloxy)ethylcarbamoyloxy]hexanoate |
| SMILES | CCC(C)(C)C(=O)OCCNC(=O)OCCCCCC(=O)OCCC(C)C.CCC(C)(C)C(=O)OCCP(=O)(O)O |
| InChI | InChI=1S/C20H37NO6.C8H17O5P/c1-6-20(4,5)18(23)26-15-12-21-19(24)27-13-9-7-8-10-17(22)25-14-11-16(2)3;1-4-8(2,3)7(9)13-5-6-14(10,11)12/h16H,6-15H2,1-5H3,(H,21,24);4-6H2,1-3H3,(H2,10,11,12) |
| InChIKey | PIHAMYSBBVHHME-UHFFFAOYSA-N |
| XLogP | 4.99 |
| TPSA | 174.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 611.71 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|