C20H36O7 — CID 165092850
[6-[2-(2,2-dimethylbutanoyloxy)ethoxy]-6-oxohexyl] 6-hydroxyhexanoate (PubChem CID 165092850) has the molecular formula C20H36O7 and a molecular weight of 388.50 g/mol. Its IUPAC name is [6-[2-(2,2-dimethylbutanoyloxy)ethoxy]-6-oxohexyl] 6-hydroxyhexanoate.
| Compound Name | [6-[2-(2,2-dimethylbutanoyloxy)ethoxy]-6-oxohexyl] 6-hydroxyhexanoate |
|---|---|
| PubChem CID | 165092850 |
| Molecular Formula | C20H36O7 |
| Molecular Weight | 388.50 g/mol |
| Exact Mass | 388.25 |
| IUPAC Name | [6-[2-(2,2-dimethylbutanoyloxy)ethoxy]-6-oxohexyl] 6-hydroxyhexanoate |
| SMILES | CCC(C)(C)C(=O)OCCOC(=O)CCCCCOC(=O)CCCCCO |
| InChI | InChI=1S/C20H36O7/c1-4-20(2,3)19(24)27-16-15-26-18(23)12-8-6-10-14-25-17(22)11-7-5-9-13-21/h21H,4-16H2,1-3H3 |
| InChIKey | IPIBMQMSOLWXPN-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 99.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.50 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|