C14H24O6 — CID 58715917
4-[4-(2,2-dimethylbutanoyloxy)butoxy]-4-oxobutanoic acid (PubChem CID 58715917) has the molecular formula C14H24O6 and a molecular weight of 288.34 g/mol. Its IUPAC name is 4-[4-(2,2-dimethylbutanoyloxy)butoxy]-4-oxobutanoic acid.
| Compound Name | 4-[4-(2,2-dimethylbutanoyloxy)butoxy]-4-oxobutanoic acid |
|---|---|
| PubChem CID | 58715917 |
| Molecular Formula | C14H24O6 |
| Molecular Weight | 288.34 g/mol |
| Exact Mass | 288.16 |
| IUPAC Name | 4-[4-(2,2-dimethylbutanoyloxy)butoxy]-4-oxobutanoic acid |
| SMILES | CCC(C)(C)C(=O)OCCCCOC(=O)CCC(=O)O |
| InChI | InChI=1S/C14H24O6/c1-4-14(2,3)13(18)20-10-6-5-9-19-12(17)8-7-11(15)16/h4-10H2,1-3H3,(H,15,16) |
| InChIKey | IAADTFHWOKDQRH-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 89.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.34 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|