C13H22O6 — CID 122578414
4-[2-(2,2-dimethylpentanoyloxy)ethoxy]-4-oxobutanoic acid (PubChem CID 122578414) has the molecular formula C13H22O6 and a molecular weight of 274.31 g/mol. Its IUPAC name is 4-[2-(2,2-dimethylpentanoyloxy)ethoxy]-4-oxobutanoic acid.
| Compound Name | 4-[2-(2,2-dimethylpentanoyloxy)ethoxy]-4-oxobutanoic acid |
|---|---|
| PubChem CID | 122578414 |
| Molecular Formula | C13H22O6 |
| Molecular Weight | 274.31 g/mol |
| Exact Mass | 274.14 |
| IUPAC Name | 4-[2-(2,2-dimethylpentanoyloxy)ethoxy]-4-oxobutanoic acid |
| SMILES | CCCC(C)(C)C(=O)OCCOC(=O)CCC(=O)O |
| InChI | InChI=1S/C13H22O6/c1-4-7-13(2,3)12(17)19-9-8-18-11(16)6-5-10(14)15/h4-9H2,1-3H3,(H,14,15) |
| InChIKey | GZLPEYNPWPHAQX-UHFFFAOYSA-N |
| XLogP | 1.76 |
| TPSA | 89.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.31 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|