C18H32O6 — CID 89151668
4-[2-(2-tert-butyl-2,4,4-trimethylpentanoyl)oxyethoxy]-4-oxobutanoic acid (PubChem CID 89151668) has the molecular formula C18H32O6 and a molecular weight of 344.45 g/mol. Its IUPAC name is 4-[2-(2-tert-butyl-2,4,4-trimethylpentanoyl)oxyethoxy]-4-oxobutanoic acid.
| Compound Name | 4-[2-(2-tert-butyl-2,4,4-trimethylpentanoyl)oxyethoxy]-4-oxobutanoic acid |
|---|---|
| PubChem CID | 89151668 |
| Molecular Formula | C18H32O6 |
| Molecular Weight | 344.45 g/mol |
| Exact Mass | 344.22 |
| IUPAC Name | 4-[2-(2-tert-butyl-2,4,4-trimethylpentanoyl)oxyethoxy]-4-oxobutanoic acid |
| SMILES | CC(C)(C)CC(C)(C(=O)OCCOC(=O)CCC(=O)O)C(C)(C)C |
| InChI | InChI=1S/C18H32O6/c1-16(2,3)12-18(7,17(4,5)6)15(22)24-11-10-23-14(21)9-8-13(19)20/h8-12H2,1-7H3,(H,19,20) |
| InChIKey | YBOBQOHJSUSQKK-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 89.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.45 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|