C16H30O4 — CID 172815297
4-oxo-4-(2,2,4,6,6-pentamethylheptan-4-yloxy)butanoic acid (PubChem CID 172815297) has the molecular formula C16H30O4 and a molecular weight of 286.41 g/mol. Its IUPAC name is 4-oxo-4-(2,2,4,6,6-pentamethylheptan-4-yloxy)butanoic acid.
| Compound Name | 4-oxo-4-(2,2,4,6,6-pentamethylheptan-4-yloxy)butanoic acid |
|---|---|
| PubChem CID | 172815297 |
| Molecular Formula | C16H30O4 |
| Molecular Weight | 286.41 g/mol |
| Exact Mass | 286.21 |
| IUPAC Name | 4-oxo-4-(2,2,4,6,6-pentamethylheptan-4-yloxy)butanoic acid |
| SMILES | CC(C)(C)CC(C)(CC(C)(C)C)OC(=O)CCC(=O)O |
| InChI | InChI=1S/C16H30O4/c1-14(2,3)10-16(7,11-15(4,5)6)20-13(19)9-8-12(17)18/h8-11H2,1-7H3,(H,17,18) |
| InChIKey | SSPOCUASGMQQNL-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.41 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |