C15H27NO6 — CID 134503020
4-[2-[2-(aminomethyl)-2,4,4-trimethylpentanoyl]oxyethoxy]-4-oxobutanoic acid (PubChem CID 134503020) has the molecular formula C15H27NO6 and a molecular weight of 317.38 g/mol. Its IUPAC name is 4-[2-[2-(aminomethyl)-2,4,4-trimethylpentanoyl]oxyethoxy]-4-oxobutanoic acid.
| Compound Name | 4-[2-[2-(aminomethyl)-2,4,4-trimethylpentanoyl]oxyethoxy]-4-oxobutanoic acid |
|---|---|
| PubChem CID | 134503020 |
| Molecular Formula | C15H27NO6 |
| Molecular Weight | 317.38 g/mol |
| Exact Mass | 317.18 |
| IUPAC Name | 4-[2-[2-(aminomethyl)-2,4,4-trimethylpentanoyl]oxyethoxy]-4-oxobutanoic acid |
| SMILES | CC(C)(C)CC(C)(CN)C(=O)OCCOC(=O)CCC(=O)O |
| InChI | InChI=1S/C15H27NO6/c1-14(2,3)9-15(4,10-16)13(20)22-8-7-21-12(19)6-5-11(17)18/h5-10,16H2,1-4H3,(H,17,18) |
| InChIKey | QFXGLTRZSRZHPA-UHFFFAOYSA-N |
| XLogP | 1.34 |
| TPSA | 115.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.38 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|