C16H26O6 — CID 88908690
4-[2-(2-tert-butyl-4-methylpent-3-enoyl)oxyethoxy]-4-oxobutanoic acid (PubChem CID 88908690) has the molecular formula C16H26O6 and a molecular weight of 314.38 g/mol. Its IUPAC name is 4-[2-(2-tert-butyl-4-methylpent-3-enoyl)oxyethoxy]-4-oxobutanoic acid.
| Compound Name | 4-[2-(2-tert-butyl-4-methylpent-3-enoyl)oxyethoxy]-4-oxobutanoic acid |
|---|---|
| PubChem CID | 88908690 |
| Molecular Formula | C16H26O6 |
| Molecular Weight | 314.38 g/mol |
| Exact Mass | 314.17 |
| IUPAC Name | 4-[2-(2-tert-butyl-4-methylpent-3-enoyl)oxyethoxy]-4-oxobutanoic acid |
| SMILES | CC(C)=CC(C(=O)OCCOC(=O)CCC(=O)O)C(C)(C)C |
| InChI | InChI=1S/C16H26O6/c1-11(2)10-12(16(3,4)5)15(20)22-9-8-21-14(19)7-6-13(17)18/h10,12H,6-9H2,1-5H3,(H,17,18) |
| InChIKey | AYOKVSYNDKSHPI-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 89.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.38 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|