C9H14O5S — CID 150156631
4-oxo-4-[2-(2-sulfanylprop-1-enoxy)ethoxy]butanoic acid (PubChem CID 150156631) has the molecular formula C9H14O5S and a molecular weight of 234.27 g/mol. Its IUPAC name is 4-oxo-4-[2-(2-sulfanylprop-1-enoxy)ethoxy]butanoic acid.
| Compound Name | 4-oxo-4-[2-(2-sulfanylprop-1-enoxy)ethoxy]butanoic acid |
|---|---|
| PubChem CID | 150156631 |
| Molecular Formula | C9H14O5S |
| Molecular Weight | 234.27 g/mol |
| Exact Mass | 234.06 |
| IUPAC Name | 4-oxo-4-[2-(2-sulfanylprop-1-enoxy)ethoxy]butanoic acid |
| SMILES | CC(S)=COCCOC(=O)CCC(=O)O |
| InChI | InChI=1S/C9H14O5S/c1-7(15)6-13-4-5-14-9(12)3-2-8(10)11/h6,15H,2-5H2,1H3,(H,10,11) |
| InChIKey | FGJGGXKTQWDCBZ-UHFFFAOYSA-N |
| XLogP | 1.20 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.27 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|