C14H22O9 — CID 89178356
4-[4-[2-(3-carboxypropanoyloxy)ethoxy]butoxy]-4-oxobutanoic acid (PubChem CID 89178356) has the molecular formula C14H22O9 and a molecular weight of 334.32 g/mol. Its IUPAC name is 4-[4-[2-(3-carboxypropanoyloxy)ethoxy]butoxy]-4-oxobutanoic acid.
| Compound Name | 4-[4-[2-(3-carboxypropanoyloxy)ethoxy]butoxy]-4-oxobutanoic acid |
|---|---|
| PubChem CID | 89178356 |
| Molecular Formula | C14H22O9 |
| Molecular Weight | 334.32 g/mol |
| Exact Mass | 334.13 |
| IUPAC Name | 4-[4-[2-(3-carboxypropanoyloxy)ethoxy]butoxy]-4-oxobutanoic acid |
| SMILES | O=C(O)CCC(=O)OCCCCOCCOC(=O)CCC(=O)O |
| InChI | InChI=1S/C14H22O9/c15-11(16)3-5-13(19)22-8-2-1-7-21-9-10-23-14(20)6-4-12(17)18/h1-10H2,(H,15,16)(H,17,18) |
| InChIKey | ULXDFQNHMCLMAP-UHFFFAOYSA-N |
| XLogP | 0.60 |
| TPSA | 136.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.32 |
| LogP ≤ 5 | 0.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|