C14H26O9 — CID 58325913
4-[2-[2-[2-[2-(2-deuteriooxyethoxy)ethoxy]ethoxy]ethoxy]ethoxy]-4-oxobutanoic acid (PubChem CID 58325913) has the molecular formula C14H26O9 and a molecular weight of 339.36 g/mol. Its IUPAC name is 4-[2-[2-[2-[2-(2-deuteriooxyethoxy)ethoxy]ethoxy]ethoxy]ethoxy]-4-oxobutanoic acid.
| Compound Name | 4-[2-[2-[2-[2-(2-deuteriooxyethoxy)ethoxy]ethoxy]ethoxy]ethoxy]-4-oxobutanoic acid |
|---|---|
| PubChem CID | 58325913 |
| Molecular Formula | C14H26O9 |
| Molecular Weight | 339.36 g/mol |
| Exact Mass | 339.16 |
| IUPAC Name | 4-[2-[2-[2-[2-(2-deuteriooxyethoxy)ethoxy]ethoxy]ethoxy]ethoxy]-4-oxobutanoic acid |
| SMILES | [2H]OCCOCCOCCOCCOCCOC(=O)CCC(=O)O |
| InChI | InChI=1S/C14H26O9/c15-3-4-19-5-6-20-7-8-21-9-10-22-11-12-23-14(18)2-1-13(16)17/h15H,1-12H2,(H,16,17)/i15D |
| InChIKey | JSIRMZCPKIUALJ-RWFJLFJASA-N |
| XLogP | -0.55 |
| TPSA | 120.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.36 |
| LogP ≤ 5 | -0.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|