C17H32O9 — CID 88546918
4-[2-[6-[2-(2-hydroxyethoxy)ethoxy]-2-methoxyhexoxy]ethoxy]-4-oxobutanoic acid (PubChem CID 88546918) has the molecular formula C17H32O9 and a molecular weight of 380.43 g/mol. Its IUPAC name is 4-[2-[6-[2-(2-hydroxyethoxy)ethoxy]-2-methoxyhexoxy]ethoxy]-4-oxobutanoic acid.
| Compound Name | 4-[2-[6-[2-(2-hydroxyethoxy)ethoxy]-2-methoxyhexoxy]ethoxy]-4-oxobutanoic acid |
|---|---|
| PubChem CID | 88546918 |
| Molecular Formula | C17H32O9 |
| Molecular Weight | 380.43 g/mol |
| Exact Mass | 380.20 |
| IUPAC Name | 4-[2-[6-[2-(2-hydroxyethoxy)ethoxy]-2-methoxyhexoxy]ethoxy]-4-oxobutanoic acid |
| SMILES | COC(CCCCOCCOCCO)COCCOC(=O)CCC(=O)O |
| InChI | InChI=1S/C17H32O9/c1-22-15(4-2-3-8-23-10-11-24-9-7-18)14-25-12-13-26-17(21)6-5-16(19)20/h15,18H,2-14H2,1H3,(H,19,20) |
| InChIKey | WIDMLWCJYZXEER-UHFFFAOYSA-N |
| XLogP | 0.62 |
| TPSA | 120.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.43 |
| LogP ≤ 5 | 0.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|