C11H20O6 — CID 141304633
4-(5,5-dimethoxypentoxy)-4-oxobutanoic acid (PubChem CID 141304633) has the molecular formula C11H20O6 and a molecular weight of 248.27 g/mol. Its IUPAC name is 4-(5,5-dimethoxypentoxy)-4-oxobutanoic acid.
| Compound Name | 4-(5,5-dimethoxypentoxy)-4-oxobutanoic acid |
|---|---|
| PubChem CID | 141304633 |
| Molecular Formula | C11H20O6 |
| Molecular Weight | 248.27 g/mol |
| Exact Mass | 248.13 |
| IUPAC Name | 4-(5,5-dimethoxypentoxy)-4-oxobutanoic acid |
| SMILES | COC(CCCCOC(=O)CCC(=O)O)OC |
| InChI | InChI=1S/C11H20O6/c1-15-11(16-2)5-3-4-8-17-10(14)7-6-9(12)13/h11H,3-8H2,1-2H3,(H,12,13) |
| InChIKey | DHJNPYSFQVHRNX-UHFFFAOYSA-N |
| XLogP | 1.18 |
| TPSA | 82.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.27 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|