C17H32O5 — CID 157076376
4-[2-(2-methyldecoxy)ethoxy]-4-oxobutanoic acid (PubChem CID 157076376) has the molecular formula C17H32O5 and a molecular weight of 316.44 g/mol. Its IUPAC name is 4-[2-(2-methyldecoxy)ethoxy]-4-oxobutanoic acid.
| Compound Name | 4-[2-(2-methyldecoxy)ethoxy]-4-oxobutanoic acid |
|---|---|
| PubChem CID | 157076376 |
| Molecular Formula | C17H32O5 |
| Molecular Weight | 316.44 g/mol |
| Exact Mass | 316.22 |
| IUPAC Name | 4-[2-(2-methyldecoxy)ethoxy]-4-oxobutanoic acid |
| SMILES | CCCCCCCCC(C)COCCOC(=O)CCC(=O)O |
| InChI | InChI=1S/C17H32O5/c1-3-4-5-6-7-8-9-15(2)14-21-12-13-22-17(20)11-10-16(18)19/h15H,3-14H2,1-2H3,(H,18,19) |
| InChIKey | ADACXKVRRILVCN-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.44 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|