C28H52O6 — CID 155153463
4-(11-hexanoyloxy-9-methylheptadecoxy)-4-oxobutanoic acid (PubChem CID 155153463) has the molecular formula C28H52O6 and a molecular weight of 484.72 g/mol. Its IUPAC name is 4-(11-hexanoyloxy-9-methylheptadecoxy)-4-oxobutanoic acid.
| Compound Name | 4-(11-hexanoyloxy-9-methylheptadecoxy)-4-oxobutanoic acid |
|---|---|
| PubChem CID | 155153463 |
| Molecular Formula | C28H52O6 |
| Molecular Weight | 484.72 g/mol |
| Exact Mass | 484.38 |
| IUPAC Name | 4-(11-hexanoyloxy-9-methylheptadecoxy)-4-oxobutanoic acid |
| SMILES | CCCCCCC(CC(C)CCCCCCCCOC(=O)CCC(=O)O)OC(=O)CCCCC |
| InChI | InChI=1S/C28H52O6/c1-4-6-8-15-18-25(34-28(32)19-13-7-5-2)23-24(3)17-14-11-9-10-12-16-22-33-27(31)21-20-26(29)30/h24-25H,4-23H2,1-3H3,(H,29,30) |
| InChIKey | YADHKPCGCSVWTM-UHFFFAOYSA-N |
| XLogP | 7.61 |
| TPSA | 89.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 24 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.72 |
| LogP ≤ 5 | 7.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|