C14H27NO7 — CID 21421399
4-[2-[2-[2-[2-(dimethylamino)ethoxy]ethoxy]ethoxy]ethoxy]-4-oxobutanoic acid (PubChem CID 21421399) has the molecular formula C14H27NO7 and a molecular weight of 321.37 g/mol. Its IUPAC name is 4-[2-[2-[2-[2-(dimethylamino)ethoxy]ethoxy]ethoxy]ethoxy]-4-oxobutanoic acid.
| Compound Name | 4-[2-[2-[2-[2-(dimethylamino)ethoxy]ethoxy]ethoxy]ethoxy]-4-oxobutanoic acid |
|---|---|
| PubChem CID | 21421399 |
| Molecular Formula | C14H27NO7 |
| Molecular Weight | 321.37 g/mol |
| Exact Mass | 321.18 |
| IUPAC Name | 4-[2-[2-[2-[2-(dimethylamino)ethoxy]ethoxy]ethoxy]ethoxy]-4-oxobutanoic acid |
| SMILES | CN(C)CCOCCOCCOCCOC(=O)CCC(=O)O |
| InChI | InChI=1S/C14H27NO7/c1-15(2)5-6-19-7-8-20-9-10-21-11-12-22-14(18)4-3-13(16)17/h3-12H2,1-2H3,(H,16,17) |
| InChIKey | KVDWORYIZZMKCL-UHFFFAOYSA-N |
| XLogP | 0.01 |
| TPSA | 94.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.37 |
| LogP ≤ 5 | 0.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|