C11H21NO6 — CID 170368150
3-[2-[2-(2-carboxyethoxy)ethyl-methylamino]ethoxy]propanoic acid (PubChem CID 170368150) has the molecular formula C11H21NO6 and a molecular weight of 263.29 g/mol. Its IUPAC name is 3-[2-[2-(2-carboxyethoxy)ethyl-methylamino]ethoxy]propanoic acid.
| Compound Name | 3-[2-[2-(2-carboxyethoxy)ethyl-methylamino]ethoxy]propanoic acid |
|---|---|
| PubChem CID | 170368150 |
| Molecular Formula | C11H21NO6 |
| Molecular Weight | 263.29 g/mol |
| Exact Mass | 263.14 |
| IUPAC Name | 3-[2-[2-(2-carboxyethoxy)ethyl-methylamino]ethoxy]propanoic acid |
| SMILES | CN(CCOCCC(=O)O)CCOCCC(=O)O |
| InChI | InChI=1S/C11H21NO6/c1-12(4-8-17-6-2-10(13)14)5-9-18-7-3-11(15)16/h2-9H2,1H3,(H,13,14)(H,15,16) |
| InChIKey | RBYXLYAHYVIBBG-UHFFFAOYSA-N |
| XLogP | -0.10 |
| TPSA | 96.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.29 |
| LogP ≤ 5 | -0.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|