C8H17NO4 — CID 90204033
3-[2-carboxyethyl(methyl)amino]propanoic acid;methane (PubChem CID 90204033) has the molecular formula C8H17NO4 and a molecular weight of 191.23 g/mol. Its IUPAC name is 3-[2-carboxyethyl(methyl)amino]propanoic acid;methane.
| Compound Name | 3-[2-carboxyethyl(methyl)amino]propanoic acid;methane |
|---|---|
| PubChem CID | 90204033 |
| Molecular Formula | C8H17NO4 |
| Molecular Weight | 191.23 g/mol |
| Exact Mass | 191.12 |
| IUPAC Name | 3-[2-carboxyethyl(methyl)amino]propanoic acid;methane |
| SMILES | C.CN(CCC(=O)O)CCC(=O)O |
| InChI | InChI=1S/C7H13NO4.CH4/c1-8(4-2-6(9)10)5-3-7(11)12;/h2-5H2,1H3,(H,9,10)(H,11,12);1H4 |
| InChIKey | RFGNPUKUQKAZPI-UHFFFAOYSA-N |
| XLogP | 0.50 |
| TPSA | 77.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 191.23 |
| LogP ≤ 5 | 0.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |