C6H14ClNO4 — CID 175013118
3-[2,2-dihydroxyethyl(methyl)amino]propanoic acid;hydrochloride (PubChem CID 175013118) has the molecular formula C6H14ClNO4 and a molecular weight of 199.63 g/mol. Its IUPAC name is 3-[2,2-dihydroxyethyl(methyl)amino]propanoic acid;hydrochloride.
| Compound Name | 3-[2,2-dihydroxyethyl(methyl)amino]propanoic acid;hydrochloride |
|---|---|
| PubChem CID | 175013118 |
| Molecular Formula | C6H14ClNO4 |
| Molecular Weight | 199.63 g/mol |
| Exact Mass | 199.06 |
| IUPAC Name | 3-[2,2-dihydroxyethyl(methyl)amino]propanoic acid;hydrochloride |
| SMILES | CN(CCC(=O)O)CC(O)O.Cl |
| InChI | InChI=1S/C6H13NO4.ClH/c1-7(4-6(10)11)3-2-5(8)9;/h6,10-11H,2-4H2,1H3,(H,8,9);1H |
| InChIKey | ZXQKOJUIZWHYKC-UHFFFAOYSA-N |
| XLogP | -0.87 |
| TPSA | 81.00 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 199.63 |
| LogP ≤ 5 | -0.87 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|