C13H25NO6 — CID 170906120
3-[2-[2-[methyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]ethoxy]ethoxy]propanoic acid (PubChem CID 170906120) has the molecular formula C13H25NO6 and a molecular weight of 291.34 g/mol. Its IUPAC name is 3-[2-[2-[methyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]ethoxy]ethoxy]propanoic acid.
| Compound Name | 3-[2-[2-[methyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]ethoxy]ethoxy]propanoic acid |
|---|---|
| PubChem CID | 170906120 |
| Molecular Formula | C13H25NO6 |
| Molecular Weight | 291.34 g/mol |
| Exact Mass | 291.17 |
| IUPAC Name | 3-[2-[2-[methyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]ethoxy]ethoxy]propanoic acid |
| SMILES | CN(CCOCCOCCC(=O)O)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C13H25NO6/c1-13(2,3)20-12(17)14(4)6-8-19-10-9-18-7-5-11(15)16/h5-10H2,1-4H3,(H,15,16) |
| InChIKey | WMKCBRQWLOVYNW-UHFFFAOYSA-N |
| XLogP | 1.36 |
| TPSA | 85.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.34 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|