C15H34N2O6 — CID 158283249
tert-butyl N-[2-(2-hydroxyethoxy)ethyl]-N-methylcarbamate;2-[2-(methylamino)ethoxy]ethanol (PubChem CID 158283249) has the molecular formula C15H34N2O6 and a molecular weight of 338.45 g/mol. Its IUPAC name is tert-butyl N-[2-(2-hydroxyethoxy)ethyl]-N-methylcarbamate;2-[2-(methylamino)ethoxy]ethanol.
| Compound Name | tert-butyl N-[2-(2-hydroxyethoxy)ethyl]-N-methylcarbamate;2-[2-(methylamino)ethoxy]ethanol |
|---|---|
| PubChem CID | 158283249 |
| Molecular Formula | C15H34N2O6 |
| Molecular Weight | 338.45 g/mol |
| Exact Mass | 338.24 |
| IUPAC Name | tert-butyl N-[2-(2-hydroxyethoxy)ethyl]-N-methylcarbamate;2-[2-(methylamino)ethoxy]ethanol |
| SMILES | CN(CCOCCO)C(=O)OC(C)(C)C.CNCCOCCO |
| InChI | InChI=1S/C10H21NO4.C5H13NO2/c1-10(2,3)15-9(13)11(4)5-7-14-8-6-12;1-6-2-4-8-5-3-7/h12H,5-8H2,1-4H3;6-7H,2-5H2,1H3 |
| InChIKey | GKLOXSMEBCEGJQ-UHFFFAOYSA-N |
| XLogP | 0.08 |
| TPSA | 100.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.45 |
| LogP ≤ 5 | 0.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|