C14H28BrNO5 — CID 178173815
tert-butyl N-[2-[2-[2-(2-bromoethoxy)ethoxy]ethoxy]ethyl]-N-methylcarbamate (PubChem CID 178173815) has the molecular formula C14H28BrNO5 and a molecular weight of 370.28 g/mol. Its IUPAC name is tert-butyl N-[2-[2-[2-(2-bromoethoxy)ethoxy]ethoxy]ethyl]-N-methylcarbamate.
| Compound Name | tert-butyl N-[2-[2-[2-(2-bromoethoxy)ethoxy]ethoxy]ethyl]-N-methylcarbamate |
|---|---|
| PubChem CID | 178173815 |
| Molecular Formula | C14H28BrNO5 |
| Molecular Weight | 370.28 g/mol |
| Exact Mass | 369.12 |
| IUPAC Name | tert-butyl N-[2-[2-[2-(2-bromoethoxy)ethoxy]ethoxy]ethyl]-N-methylcarbamate |
| SMILES | CN(CCOCCOCCOCCBr)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C14H28BrNO5/c1-14(2,3)21-13(17)16(4)6-8-19-10-12-20-11-9-18-7-5-15/h5-12H2,1-4H3 |
| InChIKey | ZVILUCPPXQXJOI-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 57.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.28 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|