C20H41NO5S2 — CID 159167986
tert-butyl N-methyl-N-[2-[2-[2-[5-methyl-5-(methyldisulfanyl)hexoxy]ethoxy]ethoxy]ethyl]carbamate (PubChem CID 159167986) has the molecular formula C20H41NO5S2 and a molecular weight of 439.68 g/mol. Its IUPAC name is tert-butyl N-methyl-N-[2-[2-[2-[5-methyl-5-(methyldisulfanyl)hexoxy]ethoxy]ethoxy]ethyl]carbamate.
| Compound Name | tert-butyl N-methyl-N-[2-[2-[2-[5-methyl-5-(methyldisulfanyl)hexoxy]ethoxy]ethoxy]ethyl]carbamate |
|---|---|
| PubChem CID | 159167986 |
| Molecular Formula | C20H41NO5S2 |
| Molecular Weight | 439.68 g/mol |
| Exact Mass | 439.24 |
| IUPAC Name | tert-butyl N-methyl-N-[2-[2-[2-[5-methyl-5-(methyldisulfanyl)hexoxy]ethoxy]ethoxy]ethyl]carbamate |
| SMILES | CSSC(C)(C)CCCCOCCOCCOCCN(C)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C20H41NO5S2/c1-19(2,3)26-18(22)21(6)11-13-24-15-17-25-16-14-23-12-9-8-10-20(4,5)28-27-7/h8-17H2,1-7H3 |
| InChIKey | JQYPCQPCPZUDSL-UHFFFAOYSA-N |
| XLogP | 4.86 |
| TPSA | 57.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.68 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'} |
|---|