C27H52N2O8 — CID 158067322
tert-butyl N-[2-[2-[2-butoxyethyl-[2-[2-[2-(2-prop-2-ynoxyethoxy)ethoxy]ethoxy]ethyl]amino]ethoxy]ethyl]-N-methylcarbamate (PubChem CID 158067322) has the molecular formula C27H52N2O8 and a molecular weight of 532.72 g/mol. Its IUPAC name is tert-butyl N-[2-[2-[2-butoxyethyl-[2-[2-[2-(2-prop-2-ynoxyethoxy)ethoxy]ethoxy]ethyl]amino]ethoxy]ethyl]-N-methylcarbamate.
| Compound Name | tert-butyl N-[2-[2-[2-butoxyethyl-[2-[2-[2-(2-prop-2-ynoxyethoxy)ethoxy]ethoxy]ethyl]amino]ethoxy]ethyl]-N-methylcarbamate |
|---|---|
| PubChem CID | 158067322 |
| Molecular Formula | C27H52N2O8 |
| Molecular Weight | 532.72 g/mol |
| Exact Mass | 532.37 |
| IUPAC Name | tert-butyl N-[2-[2-[2-butoxyethyl-[2-[2-[2-(2-prop-2-ynoxyethoxy)ethoxy]ethoxy]ethyl]amino]ethoxy]ethyl]-N-methylcarbamate |
| SMILES | C#CCOCCOCCOCCOCCN(CCOCCCC)CCOCCN(C)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C27H52N2O8/c1-7-9-15-32-17-11-29(12-18-33-16-10-28(6)26(30)37-27(3,4)5)13-19-34-21-23-36-25-24-35-22-20-31-14-8-2/h2H,7,9-25H2,1,3-6H3 |
| InChIKey | YVLSWNSLHWXFEE-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 88.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 25 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.72 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|