C21H42N2O4 — CID 118930201
tert-butyl N-[4-[[(3S)-1-butoxy-4-methyl-2-oxopentan-3-yl]-methylamino]butyl]-N-methylcarbamate (PubChem CID 118930201) has the molecular formula C21H42N2O4 and a molecular weight of 386.58 g/mol. Its IUPAC name is tert-butyl N-[4-[[(3S)-1-butoxy-4-methyl-2-oxopentan-3-yl]-methylamino]butyl]-N-methylcarbamate.
| Compound Name | tert-butyl N-[4-[[(3S)-1-butoxy-4-methyl-2-oxopentan-3-yl]-methylamino]butyl]-N-methylcarbamate |
|---|---|
| PubChem CID | 118930201 |
| Molecular Formula | C21H42N2O4 |
| Molecular Weight | 386.58 g/mol |
| Exact Mass | 386.31 |
| IUPAC Name | tert-butyl N-[4-[[(3S)-1-butoxy-4-methyl-2-oxopentan-3-yl]-methylamino]butyl]-N-methylcarbamate |
| SMILES | CCCCOCC(=O)[C@H](C(C)C)N(C)CCCCN(C)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C21H42N2O4/c1-9-10-15-26-16-18(24)19(17(2)3)22(7)13-11-12-14-23(8)20(25)27-21(4,5)6/h17,19H,9-16H2,1-8H3/t19-/m0/s1 |
| InChIKey | UWLGJSMRINHSSE-IBGZPJMESA-N |
| XLogP | 3.98 |
| TPSA | 59.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.58 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|