C23H40N2O7 — CID 126480429
tert-butyl N-[2-[2-[bis[2-(2-prop-2-ynoxyethoxy)ethyl]amino]ethoxy]ethyl]carbamate (PubChem CID 126480429) has the molecular formula C23H40N2O7 and a molecular weight of 456.58 g/mol. Its IUPAC name is tert-butyl N-[2-[2-[bis[2-(2-prop-2-ynoxyethoxy)ethyl]amino]ethoxy]ethyl]carbamate.
| Compound Name | tert-butyl N-[2-[2-[bis[2-(2-prop-2-ynoxyethoxy)ethyl]amino]ethoxy]ethyl]carbamate |
|---|---|
| PubChem CID | 126480429 |
| Molecular Formula | C23H40N2O7 |
| Molecular Weight | 456.58 g/mol |
| Exact Mass | 456.28 |
| IUPAC Name | tert-butyl N-[2-[2-[bis[2-(2-prop-2-ynoxyethoxy)ethyl]amino]ethoxy]ethyl]carbamate |
| SMILES | C#CCOCCOCCN(CCOCCNC(=O)OC(C)(C)C)CCOCCOCC#C |
| InChI | InChI=1S/C23H40N2O7/c1-6-12-27-18-20-30-16-10-25(11-17-31-21-19-28-13-7-2)9-15-29-14-8-24-22(26)32-23(3,4)5/h1-2H,8-21H2,3-5H3,(H,24,26) |
| InChIKey | MGRYPZQWMHNWAP-UHFFFAOYSA-N |
| XLogP | 1.16 |
| TPSA | 87.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.58 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|