C26H48N2O9 — CID 157489844
tert-butyl N-[2-[2-[2-propoxyethyl-[3-[2-[2-(2-prop-2-ynoxyethoxy)ethoxy]ethoxy]propanoyl]amino]ethoxy]ethyl]carbamate (PubChem CID 157489844) has the molecular formula C26H48N2O9 and a molecular weight of 532.68 g/mol. Its IUPAC name is tert-butyl N-[2-[2-[2-propoxyethyl-[3-[2-[2-(2-prop-2-ynoxyethoxy)ethoxy]ethoxy]propanoyl]amino]ethoxy]ethyl]carbamate.
| Compound Name | tert-butyl N-[2-[2-[2-propoxyethyl-[3-[2-[2-(2-prop-2-ynoxyethoxy)ethoxy]ethoxy]propanoyl]amino]ethoxy]ethyl]carbamate |
|---|---|
| PubChem CID | 157489844 |
| Molecular Formula | C26H48N2O9 |
| Molecular Weight | 532.68 g/mol |
| Exact Mass | 532.34 |
| IUPAC Name | tert-butyl N-[2-[2-[2-propoxyethyl-[3-[2-[2-(2-prop-2-ynoxyethoxy)ethoxy]ethoxy]propanoyl]amino]ethoxy]ethyl]carbamate |
| SMILES | C#CCOCCOCCOCCOCCC(=O)N(CCOCCC)CCOCCNC(=O)OC(C)(C)C |
| InChI | InChI=1S/C26H48N2O9/c1-6-12-31-16-10-28(11-17-34-15-9-27-25(30)37-26(3,4)5)24(29)8-14-33-19-21-36-23-22-35-20-18-32-13-7-2/h2H,6,8-23H2,1,3-5H3,(H,27,30) |
| InChIKey | XLNIPDWVJFXMRB-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 114.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 24 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.68 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|