C23H47NO8 — CID 159536089
tert-butyl N-[2-[2-[2-[5-[2-(2-propoxyethoxy)ethoxy]pentoxy]ethoxy]ethoxy]ethyl]carbamate (PubChem CID 159536089) has the molecular formula C23H47NO8 and a molecular weight of 465.63 g/mol. Its IUPAC name is tert-butyl N-[2-[2-[2-[5-[2-(2-propoxyethoxy)ethoxy]pentoxy]ethoxy]ethoxy]ethyl]carbamate.
| Compound Name | tert-butyl N-[2-[2-[2-[5-[2-(2-propoxyethoxy)ethoxy]pentoxy]ethoxy]ethoxy]ethyl]carbamate |
|---|---|
| PubChem CID | 159536089 |
| Molecular Formula | C23H47NO8 |
| Molecular Weight | 465.63 g/mol |
| Exact Mass | 465.33 |
| IUPAC Name | tert-butyl N-[2-[2-[2-[5-[2-(2-propoxyethoxy)ethoxy]pentoxy]ethoxy]ethoxy]ethyl]carbamate |
| SMILES | CCCOCCOCCOCCCCCOCCOCCOCCNC(=O)OC(C)(C)C |
| InChI | InChI=1S/C23H47NO8/c1-5-10-26-14-18-30-19-15-27-11-7-6-8-12-28-16-20-31-21-17-29-13-9-24-22(25)32-23(2,3)4/h5-21H2,1-4H3,(H,24,25) |
| InChIKey | UFFOTUUNEFCAST-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 93.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 23 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.63 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|