C13H29NO5 — CID 177223683
tert-butyl N-[2-[2-(2-ethoxyethoxy)ethoxy]ethyl]carbamate;molecular hydrogen (PubChem CID 177223683) has the molecular formula C13H29NO5 and a molecular weight of 279.38 g/mol. Its IUPAC name is tert-butyl N-[2-[2-(2-ethoxyethoxy)ethoxy]ethyl]carbamate;molecular hydrogen.
| Compound Name | tert-butyl N-[2-[2-(2-ethoxyethoxy)ethoxy]ethyl]carbamate;molecular hydrogen |
|---|---|
| PubChem CID | 177223683 |
| Molecular Formula | C13H29NO5 |
| Molecular Weight | 279.38 g/mol |
| Exact Mass | 279.20 |
| IUPAC Name | tert-butyl N-[2-[2-(2-ethoxyethoxy)ethoxy]ethyl]carbamate;molecular hydrogen |
| SMILES | CCOCCOCCOCCNC(=O)OC(C)(C)C.[H][H] |
| InChI | InChI=1S/C13H27NO5.H2/c1-5-16-8-9-18-11-10-17-7-6-14-12(15)19-13(2,3)4;/h5-11H2,1-4H3,(H,14,15);1H |
| InChIKey | SGNGJUJOFAFVGA-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 66.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.38 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|