C13H25NO6 — CID 156835456
2-(2-ethoxyethoxy)ethyl 2-[(2-methylpropan-2-yl)oxycarbonylamino]acetate (PubChem CID 156835456) has the molecular formula C13H25NO6 and a molecular weight of 291.34 g/mol. Its IUPAC name is 2-(2-ethoxyethoxy)ethyl 2-[(2-methylpropan-2-yl)oxycarbonylamino]acetate.
| Compound Name | 2-(2-ethoxyethoxy)ethyl 2-[(2-methylpropan-2-yl)oxycarbonylamino]acetate |
|---|---|
| PubChem CID | 156835456 |
| Molecular Formula | C13H25NO6 |
| Molecular Weight | 291.34 g/mol |
| Exact Mass | 291.17 |
| IUPAC Name | 2-(2-ethoxyethoxy)ethyl 2-[(2-methylpropan-2-yl)oxycarbonylamino]acetate |
| SMILES | CCOCCOCCOC(=O)CNC(=O)OC(C)(C)C |
| InChI | InChI=1S/C13H25NO6/c1-5-17-6-7-18-8-9-19-11(15)10-14-12(16)20-13(2,3)4/h5-10H2,1-4H3,(H,14,16) |
| InChIKey | OGMYCZWAKQNXDN-UHFFFAOYSA-N |
| XLogP | 1.11 |
| TPSA | 83.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.34 |
| LogP ≤ 5 | 1.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|