C15H30N2O6 — CID 87598465
tert-butyl N-[2-[2-[2-[(2-ethoxyacetyl)amino]ethoxy]ethoxy]ethyl]carbamate (PubChem CID 87598465) has the molecular formula C15H30N2O6 and a molecular weight of 334.41 g/mol. Its IUPAC name is tert-butyl N-[2-[2-[2-[(2-ethoxyacetyl)amino]ethoxy]ethoxy]ethyl]carbamate.
| Compound Name | tert-butyl N-[2-[2-[2-[(2-ethoxyacetyl)amino]ethoxy]ethoxy]ethyl]carbamate |
|---|---|
| PubChem CID | 87598465 |
| Molecular Formula | C15H30N2O6 |
| Molecular Weight | 334.41 g/mol |
| Exact Mass | 334.21 |
| IUPAC Name | tert-butyl N-[2-[2-[2-[(2-ethoxyacetyl)amino]ethoxy]ethoxy]ethyl]carbamate |
| SMILES | CCOCC(=O)NCCOCCOCCNC(=O)OC(C)(C)C |
| InChI | InChI=1S/C15H30N2O6/c1-5-20-12-13(18)16-6-8-21-10-11-22-9-7-17-14(19)23-15(2,3)4/h5-12H2,1-4H3,(H,16,18)(H,17,19) |
| InChIKey | KOAMPLULDMYMME-UHFFFAOYSA-N |
| XLogP | 0.70 |
| TPSA | 95.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.41 |
| LogP ≤ 5 | 0.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|