C20H44N2O7 — CID 142043663
ethane;2-ethoxy-N-[2-[2-[2-[2-[(2-ethoxyacetyl)amino]ethoxy]ethoxy]ethoxy]ethyl]acetamide (PubChem CID 142043663) has the molecular formula C20H44N2O7 and a molecular weight of 424.58 g/mol. Its IUPAC name is ethane;2-ethoxy-N-[2-[2-[2-[2-[(2-ethoxyacetyl)amino]ethoxy]ethoxy]ethoxy]ethyl]acetamide.
| Compound Name | ethane;2-ethoxy-N-[2-[2-[2-[2-[(2-ethoxyacetyl)amino]ethoxy]ethoxy]ethoxy]ethyl]acetamide |
|---|---|
| PubChem CID | 142043663 |
| Molecular Formula | C20H44N2O7 |
| Molecular Weight | 424.58 g/mol |
| Exact Mass | 424.31 |
| IUPAC Name | ethane;2-ethoxy-N-[2-[2-[2-[2-[(2-ethoxyacetyl)amino]ethoxy]ethoxy]ethoxy]ethyl]acetamide |
| SMILES | CC.CC.CCOCC(=O)NCCOCCOCCOCCNC(=O)COCC |
| InChI | InChI=1S/C16H32N2O7.2C2H6/c1-3-21-13-15(19)17-5-7-23-9-11-25-12-10-24-8-6-18-16(20)14-22-4-2;2*1-2/h3-14H2,1-2H3,(H,17,19)(H,18,20);2*1-2H3 |
| InChIKey | RAMMYQNMGXFWMJ-UHFFFAOYSA-N |
| XLogP | 1.39 |
| TPSA | 104.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.58 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|