C13H26N2O6 — CID 139325518
2-[2-[2-[[2-(2-ethoxyethoxy)acetyl]amino]ethoxy]ethoxy]-N-methylacetamide (PubChem CID 139325518) has the molecular formula C13H26N2O6 and a molecular weight of 306.36 g/mol. Its IUPAC name is 2-[2-[2-[[2-(2-ethoxyethoxy)acetyl]amino]ethoxy]ethoxy]-N-methylacetamide.
| Compound Name | 2-[2-[2-[[2-(2-ethoxyethoxy)acetyl]amino]ethoxy]ethoxy]-N-methylacetamide |
|---|---|
| PubChem CID | 139325518 |
| Molecular Formula | C13H26N2O6 |
| Molecular Weight | 306.36 g/mol |
| Exact Mass | 306.18 |
| IUPAC Name | 2-[2-[2-[[2-(2-ethoxyethoxy)acetyl]amino]ethoxy]ethoxy]-N-methylacetamide |
| SMILES | CCOCCOCC(=O)NCCOCCOCC(=O)NC |
| InChI | InChI=1S/C13H26N2O6/c1-3-18-6-8-21-11-13(17)15-4-5-19-7-9-20-10-12(16)14-2/h3-11H2,1-2H3,(H,14,16)(H,15,17) |
| InChIKey | UATUGJQAFUOLLV-UHFFFAOYSA-N |
| XLogP | -1.07 |
| TPSA | 95.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.36 |
| LogP ≤ 5 | -1.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|