C20H40N2O7 — CID 134582817
2-[2-[2-[5-[[2-(2-butoxyethoxy)acetyl]amino]pentoxy]ethoxy]ethoxy]-N-methylacetamide (PubChem CID 134582817) has the molecular formula C20H40N2O7 and a molecular weight of 420.55 g/mol. Its IUPAC name is 2-[2-[2-[5-[[2-(2-butoxyethoxy)acetyl]amino]pentoxy]ethoxy]ethoxy]-N-methylacetamide.
| Compound Name | 2-[2-[2-[5-[[2-(2-butoxyethoxy)acetyl]amino]pentoxy]ethoxy]ethoxy]-N-methylacetamide |
|---|---|
| PubChem CID | 134582817 |
| Molecular Formula | C20H40N2O7 |
| Molecular Weight | 420.55 g/mol |
| Exact Mass | 420.28 |
| IUPAC Name | 2-[2-[2-[5-[[2-(2-butoxyethoxy)acetyl]amino]pentoxy]ethoxy]ethoxy]-N-methylacetamide |
| SMILES | CCCCOCCOCC(=O)NCCCCCOCCOCCOCC(=O)NC |
| InChI | InChI=1S/C20H40N2O7/c1-3-4-9-25-13-15-29-18-20(24)22-8-6-5-7-10-26-11-12-27-14-16-28-17-19(23)21-2/h3-18H2,1-2H3,(H,21,23)(H,22,24) |
| InChIKey | ZLWDVKMQBSOLGY-UHFFFAOYSA-N |
| XLogP | 0.90 |
| TPSA | 104.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.55 |
| LogP ≤ 5 | 0.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|